30243-77-7 Usage
Explanation
The molecular formula represents the number of atoms of each element present in a molecule of the compound.
Explanation
This describes the arrangement of atoms and the type of chemical bonds in the compound.
Explanation
The compound is a derivative of the parent molecule, which is a triazine with three carbonyl groups (trione).
Explanation
The compound is used as an intermediate in the production of various products, including pharmaceuticals, agrochemicals, dyes, pigments, and other industrial chemicals.
5. Antimicrobial and Antiviral Properties
Explanation
The compound has been found to exhibit antimicrobial and antiviral properties, which makes it potentially useful in the development of new drugs and treatments.
Explanation
The compound is classified as a heterocyclic compound, which means it contains a ring of atoms with at least one atom being a non-carbon atom (in this case, nitrogen).
Explanation
The compound is likely to be soluble in polar solvents, such as water or alcohol, due to the presence of polar functional groups in its structure.
Explanation
The compound is generally stable under normal conditions, such as room temperature and pressure, without undergoing significant decomposition or reaction.
Explanation
As a chemical compound, it may have hazardous properties, such as being an irritant or toxic, and should be handled with care and proper safety measures.
Explanation
The compound's regulatory status may vary depending on its intended use and concentration in a product, which could be subject to specific regulations and guidelines.
Chemical Structure
1,3,5-Triazine-2,4,6(1H,3H,5H)-trione, 1-cyclohexyl-3-methyl-
Trione Derivative
1-cyclohexyl-3-methyl-1,3,5-triazine-2,4,6(1H,3H,5H)-trione
Applications
Pharmaceutical and agrochemical synthesis, dyes, pigments, and industrial chemicals
Chemical Classification
Heterocyclic compound
Solubility
Soluble in polar solvents
Stability
Stable under normal conditions
Hazardous Properties
Potential irritant or toxic
Regulatory Status
May be subject to specific regulations depending on its use and concentration
Check Digit Verification of cas no
The CAS Registry Mumber 30243-77-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,0,2,4 and 3 respectively; the second part has 2 digits, 7 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 30243-77:
(7*3)+(6*0)+(5*2)+(4*4)+(3*3)+(2*7)+(1*7)=77
77 % 10 = 7
So 30243-77-7 is a valid CAS Registry Number.
InChI:InChI=1/C10H15N3O3/c1-12-8(14)11-9(15)13(10(12)16)7-5-3-2-4-6-7/h7H,2-6H2,1H3,(H,11,14,15)