30380-27-9 Usage
General Description
5-aminooxazole-4-carboxamide, also known as AICA or ZMP, is a chemical compound with the molecular formula C4H5N3O2. It is a derivative of oxazole and is known for its role as an intermediate in the purine biosynthesis pathway. AICA is also a precursor to the nucleotide ZTP, which has been implicated in the regulation of energy metabolism and cellular stress response. Additionally, AICA has been studied for its potential therapeutic effects in various conditions, including diabetes, neurodegenerative diseases, and cancer. Its structural similarity to adenosine has also led to investigations into its potential as an adenosine receptor agonist. Overall, AICA is a versatile chemical with potential implications for various biological processes and therapeutic applications.
Check Digit Verification of cas no
The CAS Registry Mumber 30380-27-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,0,3,8 and 0 respectively; the second part has 2 digits, 2 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 30380-27:
(7*3)+(6*0)+(5*3)+(4*8)+(3*0)+(2*2)+(1*7)=79
79 % 10 = 9
So 30380-27-9 is a valid CAS Registry Number.
InChI:InChI=1/C4H5N3O2/c5-3(8)2-4(6)9-1-7-2/h1H,6H2,(H2,5,8)