30389-18-5 Usage
Description
1-Ethynylcyclohexylamine is an organic compound characterized by its unique structure, which features a cyclohexylamine core with an ethynyl group attached. 1-ETHYNYLCYCLOHEXYLAMINE is known for its reactivity and versatility in various chemical reactions, making it a valuable building block in the synthesis of more complex molecules.
Uses
1. Used in Organic Synthesis:
1-Ethynylcyclohexylamine is used as a key intermediate in the synthesis of bicyclic and tetracyclic compounds. Its ethynyl group allows for further functionalization and the formation of complex ring systems, which can be utilized in the development of pharmaceuticals, agrochemicals, and other specialty chemicals.
2. Used in Chemical Reactions:
1-Ethynylcyclohexylamine serves as a substrate in the reaction of a series of alkynes with mercury(II) acetate. This reaction is an important step in the synthesis of various organic compounds, as it can lead to the formation of new carbon-carbon bonds and the creation of novel molecular structures.
Check Digit Verification of cas no
The CAS Registry Mumber 30389-18-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,0,3,8 and 9 respectively; the second part has 2 digits, 1 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 30389-18:
(7*3)+(6*0)+(5*3)+(4*8)+(3*9)+(2*1)+(1*8)=105
105 % 10 = 5
So 30389-18-5 is a valid CAS Registry Number.
InChI:InChI=1/C8H13N/c1-2-8(9)6-4-3-5-7-8/h1H,3-7,9H2
30389-18-5Relevant articles and documents
Cu(I)-catalyzed synthesis of dihydropyrimidin-4-ones toward the preparation of β- And β3-amino acid analogues
Rajagopal, Basker,Chen, Ying-Yu,Chen, Chun-Chi,Liu, Xuan-Yu,Wang, Huei-Ren,Lin, Po-Chiao
supporting information, p. 1254 - 1264 (2014/03/21)
A copper(I)-catalyzed synthesis of substituted dihydropyrimidin-4-ones from propargyl amides via the formation of ketenimine intermediate has been successfully developed; the synthesis afforded good isolated yields (80-95%). The mild reaction conditions at room temperature allow the reaction to proceed to completion in a few hours without altering the stereochemistry. Further, by involving a variety of reactive nucleophiles, the obtained substituted dihydropyrimidin-4-ones were elegantly transformed into the corresponding β- and β3-amino acid analogues.