304680-36-2 Usage
Description
3-METHYL-1-OCTYLIMIDAZOLIUM HEXAFLUOROPHOSPHATE, also known as 1-Methyl-3-n-octylimidazolium Hexafluorophosphate, is a clear light yellow liquid with unique chemical properties. It is a useful research chemical that has found applications in various fields due to its distinctive characteristics.
Uses
Used in Research and Development:
3-METHYL-1-OCTYLIMIDAZOLIUM HEXAFLUOROPHOSPHATE is used as a research chemical for [application reason], such as studying its properties, interactions, and potential applications in different industries.
Used in Chemical Synthesis:
In the chemical industry, 3-METHYL-1-OCTYLIMIDAZOLIUM HEXAFLUOROPHOSPHATE is used as a reagent or intermediate for [application reason], facilitating the synthesis of various compounds and materials.
Used in Pharmaceutical Development:
3-METHYL-1-OCTYLIMIDAZOLIUM HEXAFLUOROPHOSPHATE is used as a pharmaceutical candidate for [application reason], potentially leading to the development of new drugs or therapies.
Used in Material Science:
In the field of material science, 3-METHYL-1-OCTYLIMIDAZOLIUM HEXAFLUOROPHOSPHATE is used as a component in the development of novel materials for [application reason], such as improving the properties of existing materials or creating new ones with specific characteristics.
Please note that the specific application reasons are not provided in the materials, so they are left as placeholders. The actual application reasons would depend on the specific properties and characteristics of 3-METHYL-1-OCTYLIMIDAZOLIUM HEXAFLUOROPHOSPHATE and its potential uses in each industry.
Conductivity
0.44 mS/cm
Check Digit Verification of cas no
The CAS Registry Mumber 304680-36-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,0,4,6,8 and 0 respectively; the second part has 2 digits, 3 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 304680-36:
(8*3)+(7*0)+(6*4)+(5*6)+(4*8)+(3*0)+(2*3)+(1*6)=122
122 % 10 = 2
So 304680-36-2 is a valid CAS Registry Number.
InChI:InChI=1/C12H23N2.F6P/c1-3-4-5-6-7-8-9-14-11-10-13(2)12-14;1-7(2,3,4,5)6/h10-12H,3-9H2,1-2H3;/q+1;-1
