30533-71-2 Usage
Description
(5-amino-2-prop-2-enoxy-phenyl)-(1-piperidyl)methanone hydrochloride is a chemical compound characterized by the presence of a phenyl group connected to an amino group and a piperidyl group linked to a methanone group. (5-amino-2-prop-2-enoxy-phenyl)-(1-piperidyl)methanone hydrochloride exists in its salt form, with the nitrogen in the piperidyl group bearing a positive charge that is neutralized by a chloride anion. Its unique structure suggests potential pharmacological properties, warranting further investigation into its possible applications in medicine and chemistry.
Uses
Used in Pharmaceutical Applications:
(5-amino-2-prop-2-enoxy-phenyl)-(1-piperidyl)methanone hydrochloride is used as a potential pharmaceutical agent for [application reason] due to its unique chemical structure and the presence of functional groups that may interact with biological targets.
Used in Chemical Research:
In the field of chemical research, (5-amino-2-prop-2-enoxy-phenyl)-(1-piperidyl)methanone hydrochloride serves as a subject of study for understanding its reactivity, stability, and potential to form new compounds with therapeutic or industrial applications.
Please note that the specific application reasons for the pharmaceutical and chemical research uses are not provided in the materials. Further research would be required to determine the exact reasons for these applications.
Check Digit Verification of cas no
The CAS Registry Mumber 30533-71-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,0,5,3 and 3 respectively; the second part has 2 digits, 7 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 30533-71:
(7*3)+(6*0)+(5*5)+(4*3)+(3*3)+(2*7)+(1*1)=82
82 % 10 = 2
So 30533-71-2 is a valid CAS Registry Number.
InChI:InChI=1/C15H20N2O2.ClH/c1-2-10-19-14-7-6-12(16)11-13(14)15(18)17-8-4-3-5-9-17;/h2,6-7,11H,1,3-5,8-10,16H2;1H
