306934-90-7 Usage
Description
7-IODO-3,4-DIHYDRO-2H-1,5-BENZODIOXEPINE is an organic compound that serves as a key intermediate in the synthesis of various pharmaceutical compounds, particularly N-arylated lactam-type iminosugars. It is characterized by its unique chemical structure, which includes a benzodioxepine ring with an iodine atom at the 7th position and a dihydro functionality at the 3rd and 4th positions.
Uses
Used in Pharmaceutical Industry:
7-IODO-3,4-DIHYDRO-2H-1,5-BENZODIOXEPINE is used as a key intermediate for the preparation of N-arylated lactam-type iminosugars, which are important compounds in the development of novel pharmaceuticals. These iminosugars have potential applications in the treatment of various diseases, including cancer, due to their ability to inhibit specific enzymes and disrupt cellular processes.
Additionally, the compound can be used in the study of structure-activity relationships of N-arylated lactam-type iminosugars, which is crucial for understanding their biological activities and optimizing their therapeutic potential. This application is particularly relevant in drug discovery and development, as it helps researchers identify the most effective and selective compounds for targeting specific biological pathways.
Check Digit Verification of cas no
The CAS Registry Mumber 306934-90-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,0,6,9,3 and 4 respectively; the second part has 2 digits, 9 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 306934-90:
(8*3)+(7*0)+(6*6)+(5*9)+(4*3)+(3*4)+(2*9)+(1*0)=147
147 % 10 = 7
So 306934-90-7 is a valid CAS Registry Number.
InChI:InChI=1/C9H9IO2/c10-7-2-3-8-9(6-7)12-5-1-4-11-8/h2-3,6H,1,4-5H2
