30880-64-9 Usage
General Description
"2-[(2-Chloro-4-nitrophenyl)sulfanyl]acetic acid is a complex chemical compound that is made up of several different elements. It predominantly contains molecules of hydrogen, chlorine, sulfur, nitrogen, and oxygen, bound together in various configurations. 2-[(2-CHLORO-4-NITROPHENYL)SULFANYL]ACETIC ACID has diverse potential applications in chemical engineering and biochemistry due to its reactive characteristics resulting from the nitro substituted phenyl group and the chloro and sulfanyl functional groups. Precise information on its use, properties, and safety measures, however, varies depending on specific contexts and should be gleaned from dependable scientific resources.
Check Digit Verification of cas no
The CAS Registry Mumber 30880-64-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,0,8,8 and 0 respectively; the second part has 2 digits, 6 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 30880-64:
(7*3)+(6*0)+(5*8)+(4*8)+(3*0)+(2*6)+(1*4)=109
109 % 10 = 9
So 30880-64-9 is a valid CAS Registry Number.
InChI:InChI=1/C8H6ClNO4S/c9-6-3-5(10(13)14)1-2-7(6)15-4-8(11)12/h1-3H,4H2,(H,11,12)
