30953-58-3 Usage
Description
[2-(2-CHLORO-PHENYL)-ETHYL]-HYDRAZINE is a chemical compound belonging to the hydrazine family, characterized by a hydrazine group with two nitrogen atoms bonded together, attached to an ethyl group and a 2-chloro-phenyl group. This unique chemical structure endows it with potential applications in various industries, particularly pharmaceutical and agrochemical, due to its possible biological activities. However, it is crucial to handle this compound with proper care, as hydrazine-containing compounds can be hazardous if not managed or stored correctly.
Uses
Used in Pharmaceutical Industry:
[2-(2-CHLORO-PHENYL)-ETHYL]-HYDRAZINE is used as a chemical intermediate for the synthesis of various pharmaceutical compounds. Its unique structure may contribute to the development of new drugs with specific biological activities, making it a valuable asset in drug discovery and design.
Used in Agrochemical Industry:
In the agrochemical industry, [2-(2-CHLORO-PHENYL)-ETHYL]-HYDRAZINE is used as a building block for the creation of novel agrochemicals, such as pesticides and herbicides. Its chemical properties may allow for the development of more effective and targeted products, enhancing crop protection and yield.
Check Digit Verification of cas no
The CAS Registry Mumber 30953-58-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,0,9,5 and 3 respectively; the second part has 2 digits, 5 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 30953-58:
(7*3)+(6*0)+(5*9)+(4*5)+(3*3)+(2*5)+(1*8)=113
113 % 10 = 3
So 30953-58-3 is a valid CAS Registry Number.
InChI:InChI=1/C8H11ClN2/c9-8-4-2-1-3-7(8)5-6-11-10/h1-4,11H,5-6,10H2
