30955-94-3 Usage
Description
2-ACETYL-5-IODOTHIOPHENE is an organic compound with the molecular formula C6H5IOS. It is a derivative of thiophene, a heterocyclic compound consisting of a five-membered ring with two hydrogen atoms replaced by a sulfur atom. The 2-acetyl group indicates the presence of an acetyl (COCH3) functional group at the 2nd position, while the 5-iodo group signifies an iodine atom attached at the 5th position of the thiophene ring. 2-ACETYL-5-IODOTHIOPHENE is known for its chemical reactivity and potential applications in various industries.
Uses
Used in Chemical Synthesis:
2-ACETYL-5-IODOTHIOPHENE is used as a chemical intermediate for the synthesis of other complex organic compounds. Its unique structure allows it to participate in various chemical reactions, leading to the formation of new molecules with different properties and applications.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 2-ACETYL-5-IODOTHIOPHENE is used as a building block for the development of novel therapeutic agents. Its reactivity enables the creation of new drug candidates with potential applications in treating various diseases and medical conditions.
Used in Material Science:
2-ACETYL-5-IODOTHIOPHENE can be utilized in the development of new materials with specific properties, such as conductivity, magnetism, or optical characteristics. These materials can find applications in various fields, including electronics, sensors, and energy storage devices.
Used in Research and Development:
As a versatile compound, 2-ACETYL-5-IODOTHIOPHENE is also used in research and development laboratories for studying its chemical properties, reactivity, and potential applications in different fields. This helps scientists and researchers to better understand its behavior and develop new strategies for its utilization.
For example, it can react with 5-Ethyl-4-methyl-thiazole to get 2-Acetyl-5-(5-ethyl-4-methyl-2-thiazolyl)thiophene in the presence of solvent acetonitrile and other conditions of heating for 4 hours. This reaction demonstrates the compound's ability to form new molecules with potential applications in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 30955-94-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,0,9,5 and 5 respectively; the second part has 2 digits, 9 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 30955-94:
(7*3)+(6*0)+(5*9)+(4*5)+(3*5)+(2*9)+(1*4)=123
123 % 10 = 3
So 30955-94-3 is a valid CAS Registry Number.
InChI:InChI=1/C6H5IOS/c1-4(8)5-2-3-6(7)9-5/h2-3H,1H3
30955-94-3Relevant articles and documents
Cobalt-catalyzed preparation of arylindium reagents from aryl and heteroaryl bromides
Adak, Laksmikanta,Yoshikai, Naohiko
experimental part, p. 7563 - 7568 (2011/11/12)
A cobalt-bathophenanthroline catalyst has been developed for the direct preparation of a variety of arylindium reagents from the corresponding aryl and heteroaryl bromides in the presence of indium metal and lithium chloride. The thus-formed arylindium reagents undergo efficient palladium-catalyzed cross-coupling reactions with aryl iodides, tolerating various functional groups including hydroxy and free amino groups.
Bis-(trifluoroacetoxy)iodobenzene-iodine system: An efficient and selective reagent for iodination of thiophene derivatives
D'Auria,Mauriello
, p. 4883 - 4884 (2007/10/02)
Bis-(trifluoroacetoxy)iodobenzene-iodine system is a good iodinating reagent of thiophene derivatives giving products with iodine atom in α-position on the thiophene ring.
Photochemical Synthesis of Phenyl-2-thienyl Derivatives
Antonioletti, Roberto,Auria, Maurizio D',Onofrio, Franco D',Piancatelli, Giovanni,Scettri, Arrigo
, p. 1755 - 1758 (2007/10/02)
The irradiation (in benzene solution) of 5-bromo- and 5-iodo-thiophene-2-carbaldehyde or the corresponding methyl ketones furnishes the corresponding 5-phenyl derivatives.The same reactivity for other halogenothiophenes is reported: 3,5-dibromothiophene-2-carbaldehyde furnishes the 3-bromo-5-phenyl-2-thienyl derivative while the corresponding di-iodo compound yields 3,5-diphenylthiophene-2-carbaldehyde.In contrast, 5-acetyl-2,3-di-iodothiophene furnishes only the photosubstitution pruduct at C-5.Generally the iodine-containing compounds are more reactive and more stable under the reaction conditions than ones bearing bromine, in agreement with previous reports on the corresponding furan photochemistry.
