312623-76-0 Usage
Description
(S)-(-)1 2 3 4-TETRAHYDRO-6 7DI-MEO-3-I&, a tetrahydroisoquinoline derivative, is a chemical compound with a complex molecular structure. It features two methoxy substituents and an iodine atom, which contribute to its versatile properties and potential pharmacological activities. (S)-(-)1 2 3 4-TETRAHYDRO-6 7DI-MEO-3-I& holds promise in medicinal chemistry, drug development, and research related to its biological effects and interactions.
Uses
Used in Pharmaceutical Industry:
(S)-(-)1 2 3 4-TETRAHYDRO-6 7DI-MEO-3-I& is used as a potential candidate for drug development due to its versatile structure and properties. Its unique molecular composition allows for various pharmacological activities, making it a valuable compound for further research and analysis in the field of medicinal chemistry.
Used in Research and Studies:
(S)-(-)1 2 3 4-TETRAHYDRO-6 7DI-MEO-3-I& is utilized as a subject of research to explore its biological effects and interactions. (S)-(-)1 2 3 4-TETRAHYDRO-6 7DI-MEO-3-I&'s complex structure and potential pharmacological activities make it an interesting subject for scientists to study and understand its implications in various biological processes and potential applications.
Check Digit Verification of cas no
The CAS Registry Mumber 312623-76-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,1,2,6,2 and 3 respectively; the second part has 2 digits, 7 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 312623-76:
(8*3)+(7*1)+(6*2)+(5*6)+(4*2)+(3*3)+(2*7)+(1*6)=110
110 % 10 = 0
So 312623-76-0 is a valid CAS Registry Number.
InChI:InChI=1/C12H15NO4.C7H8O3S/c1-16-10-4-7-3-9(12(14)15)13-6-8(7)5-11(10)17-2;1-6-2-4-7(5-3-6)11(8,9)10/h4-5,9,13H,3,6H2,1-2H3,(H,14,15);2-5H,1H3,(H,8,9,10)/t9-;/m0./s1
