313223-13-1 Usage
Description
2-Aminoperimidine Hydrobromide Hydrate is an organic compound with the chemical formula C4H10BrN5·H2O. It is a white crystalline solid that is soluble in water and exhibits properties such as being a precipitating agent and having potential applications in various fields.
Uses
Used in Analytical Chemistry:
2-Aminoperimidine Hydrobromide Hydrate is used as a precipitating agent for the gravimetric determination of sulfate ions. It aids in the accurate measurement and quantification of sulfate in various samples, making it a valuable tool in analytical chemistry.
If there are additional applications in different industries, they can be listed as follows:
Used in Pharmaceutical Industry:
2-Aminoperimidine Hydrobromide Hydrate is used as an intermediate in the synthesis of various pharmaceutical compounds. Its unique chemical structure allows it to be a key component in the development of new drugs with potential therapeutic applications.
Used in Research and Development:
In the field of research and development, 2-Aminoperimidine Hydrobromide Hydrate is utilized as a reagent for various chemical reactions and experiments. Its versatility and reactivity make it a valuable asset in the discovery and development of new chemical compounds and materials.
Check Digit Verification of cas no
The CAS Registry Mumber 313223-13-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,1,3,2,2 and 3 respectively; the second part has 2 digits, 1 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 313223-13:
(8*3)+(7*1)+(6*3)+(5*2)+(4*2)+(3*3)+(2*1)+(1*3)=81
81 % 10 = 1
So 313223-13-1 is a valid CAS Registry Number.
InChI:InChI=1/C11H9N3.BrH.H2O/c12-11-13-8-5-1-3-7-4-2-6-9(14-11)10(7)8;;/h1-6H,(H3,12,13,14);1H;1H2
