3164-85-0 Usage
Description
Potassium 2-ethylhexanoate, also known as potassium hexanoate, is an organic compound with the chemical formula C8H15O2K. It is a colorless liquid with a mild odor and is soluble in water. It is a derivative of 2-ethylhexanoic acid and is commonly used as a catalyst in various chemical reactions.
Uses
Used in Polyester and Isocyanurate Foam Industry:
Potassium 2-ethylhexanoate is used as an initiator for the production of polyester and isocyanurate foam. It helps to initiate the polymerization reaction, leading to the formation of the desired polymer.
Used in Phase-Transfer Catalysis:
Potassium 2-ethylhexanoate is used as a phase-transfer catalyst in various chemical reactions. It facilitates the transfer of reactants between two immiscible phases, such as a liquid-liquid or liquid-solid system, and enhances the reaction rate and efficiency.
Used in Trimerization Catalysts:
Potassium 2-ethylhexanoate is used as a trimerization catalyst in the production of certain chemicals. It helps to promote the trimerization reaction, leading to the formation of the desired product.
Flammability and Explosibility
Nonflammable
Check Digit Verification of cas no
The CAS Registry Mumber 3164-85-0 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 3,1,6 and 4 respectively; the second part has 2 digits, 8 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 3164-85:
(6*3)+(5*1)+(4*6)+(3*4)+(2*8)+(1*5)=80
80 % 10 = 0
So 3164-85-0 is a valid CAS Registry Number.
InChI:InChI=1/C8H16O2.K.H2O/c1-3-5-6-7(4-2)8(9)10;;/h7H,3-6H2,1-2H3,(H,9,10);;1H2/q;+1;