32089-46-6 Usage
Description
(4-CHLORO-PYRAZOL-1-YL)-ACETIC ACID is an organic compound with the molecular structure featuring a chloro-pyrazol-1-yl group attached to an acetic acid moiety. It is known for its potential applications in various fields, particularly in the pharmaceutical and chemical industries, due to its unique chemical properties and reactivity.
Uses
Used in Pharmaceutical Industry:
(4-CHLORO-PYRAZOL-1-YL)-ACETIC ACID is used as a key intermediate compound for the synthesis of bicyclic compounds. These bicyclic compounds are designed to reduce the production of β-amyloid peptide, which is associated with neurodegenerative diseases such as Alzheimer's. By targeting the reduction of β-amyloid peptide, these compounds may help in the development of potential therapeutic agents for the treatment of Alzheimer's and related conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 32089-46-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,2,0,8 and 9 respectively; the second part has 2 digits, 4 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 32089-46:
(7*3)+(6*2)+(5*0)+(4*8)+(3*9)+(2*4)+(1*6)=106
106 % 10 = 6
So 32089-46-6 is a valid CAS Registry Number.
InChI:InChI=1/C5H5ClN2O2/c6-4-1-7-8(2-4)3-5(9)10/h1-2H,3H2,(H,9,10)