321429-49-6 Usage
Description
(R)-1-(3-Fluorophenyl)ethylamine hydrochloride is a chiral, fluorinated arylamine derivative that serves as a key intermediate in the synthesis of various pharmaceutical compounds. It is characterized by its unique molecular structure, which includes a fluorine atom attached to a phenyl ring and an ethylamine group. (R)-1-(3-Fluorophenyl)ethylamine hydrochloride is essential in the development of medications with specific therapeutic properties.
Uses
Used in Pharmaceutical Industry:
(R)-1-(3-Fluorophenyl)ethylamine hydrochloride is used as a building block for the synthesis of compounds with anticonvulsant activity. Its unique structure allows for the creation of new molecules that can potentially treat seizures and other related neurological disorders by modulating the activity of ion channels in the brain.
Used in Medicinal Chemistry Research:
In the field of medicinal chemistry, (R)-1-(3-Fluorophenyl)ethylamine hydrochloride serves as a valuable starting material for the development of novel therapeutic agents. Its fluorinated arylamine structure can be further modified and optimized to enhance the potency, selectivity, and pharmacokinetic properties of the resulting compounds, leading to more effective treatments for various diseases.
Used in Drug Design and Development:
(R)-1-(3-Fluorophenyl)ethylamine hydrochloride is utilized in drug design and development to create new molecules with improved pharmacological profiles. Its chiral nature allows for the exploration of stereoselective interactions with biological targets, which can lead to the discovery of more potent and selective drugs with fewer side effects.
Check Digit Verification of cas no
The CAS Registry Mumber 321429-49-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,2,1,4,2 and 9 respectively; the second part has 2 digits, 4 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 321429-49:
(8*3)+(7*2)+(6*1)+(5*4)+(4*2)+(3*9)+(2*4)+(1*9)=116
116 % 10 = 6
So 321429-49-6 is a valid CAS Registry Number.
InChI:InChI=1/C8H10FN.ClH/c1-6(10)7-3-2-4-8(9)5-7;/h2-6H,10H2,1H3;1H/t6-;/m1./s1
321429-49-6Relevant articles and documents
NOVEL URACIL COMPOUND HAVING INHIBITORY ACTIVITY ON HUMAN DEOXYURIDINE TRIPHOSPHATASE OR SALT THEREOF
-
Page/Page column 52, (2011/04/18)
Provided is a uracil compound or a salt thereof, which has potent human dUTPase inhibitory activity and is useful as, for example, an antitumor drug. A uracil compound represented by the general formula (I) or a salt thereof: wherein n represents an integer of 1 to 3; X represents a bond, an oxygen atom, a sulfur atom, or the like; Y represents a linear or branched alkylene group having 1 to 8 carbon atoms, or the like; and Z represents -SO2NR1R2 or -NR3SO2-R4, wherein R1 and R2 each represent an alkyl group having 1 to 6 carbon atoms, an aralkyl group which is optionally substituted, or the like; R3 represents an alkyl group having 1 to 6 carbon atoms, or the like; and R4 represents an aromatic hydrocarbon group, an unsaturated heterocyclic group, or the like.
