32292-78-7 Usage
Description
2-formyl-3,5-dihydroxyphenyl benzoate is an organic compound that serves as an intermediate in the synthesis of various plant-based compounds. It is characterized by its unique chemical structure, which includes a formyl group, two hydroxyl groups, and a benzoate group attached to a phenyl ring.
Uses
Used in Pharmaceutical Industry:
2-formyl-3,5-dihydroxyphenyl benzoate is used as an intermediate for the synthesis of Hirsutidin Chloride (H356800), an anthocyanidin found in the Madagascar Periwinkle (Catharanthus Roseus). 2-formyl-3,5-dihydroxyphenyl benzoate is known for its potential applications in the development of plant-based compounds to lower LDL cholesterol, which can contribute to the treatment and prevention of cardiovascular diseases.
Used in Chemical Synthesis:
2-formyl-3,5-dihydroxyphenyl benzoate is also used as a key intermediate in the synthesis of other complex organic molecules, particularly those with potential applications in the pharmaceutical, agrochemical, and material science industries. Its unique chemical structure allows for further functionalization and modification, making it a versatile building block for the development of novel compounds with diverse properties and applications.
Check Digit Verification of cas no
The CAS Registry Mumber 32292-78-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,2,2,9 and 2 respectively; the second part has 2 digits, 7 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 32292-78:
(7*3)+(6*2)+(5*2)+(4*9)+(3*2)+(2*7)+(1*8)=107
107 % 10 = 7
So 32292-78-7 is a valid CAS Registry Number.
InChI:InChI=1/C14H10O5/c15-8-11-12(17)6-10(16)7-13(11)19-14(18)9-4-2-1-3-5-9/h1-8,16-17H
32292-78-7Relevant articles and documents
Biomimetic synthesis of nudicaulins i and II, yellow pigments from the Iceland poppy: Papaver nudicaule
Devlin, Rory,Sperry, Jonathan
supporting information, p. 13594 - 13597 (2019/11/14)
Indole and the anthocyanin orientalin proceed through a unique cascade sequence that leads to nudicaulins I and II in 92% yield. This biomimetic synthesis confirms the biosynthesis proposal for these structurally unprecedented flavoalkaloids that play a key role in the colour range displayed by the Iceland poppy.