32449-49-3 Usage
Chemical composition
Contains a selenium atom and selenocyanate functional group, attached to an isoindole-1,3-dione moiety.
Molecular structure
Member of the isoindole family.
Biological activities
Exhibits diverse biological activities, including anticancer, antiviral, and antibacterial properties.
Medicinal properties
Potential for use in the development of new drugs or materials due to its potential biological activities.
Selenium incorporation
Adds to the compound's potential medicinal properties, as selenium is known for its antioxidant and anti-inflammatory effects.
Check Digit Verification of cas no
The CAS Registry Mumber 32449-49-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,2,4,4 and 9 respectively; the second part has 2 digits, 4 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 32449-49:
(7*3)+(6*2)+(5*4)+(4*4)+(3*9)+(2*4)+(1*9)=113
113 % 10 = 3
So 32449-49-3 is a valid CAS Registry Number.
InChI:InChI=1/C11H8N2O2Se/c12-7-16-6-5-13-10(14)8-3-1-2-4-9(8)11(13)15/h1-4H,5-6H2