3252-36-6 Usage
Description
5-BROMO-4-CHLORO-3-INDOLYL ACETATE is an acetate ester derived from the formal condensation of the carboxy group of acetic acid with the hydroxy group of 5-bromo-4-chloroindoxyl. It is a solid chemical compound with a specific molecular structure that makes it suitable for various applications in different industries.
Uses
Used in Histochemical Applications:
5-BROMO-4-CHLORO-3-INDOLYL ACETATE is used as a histochemical substrate for esterase. It serves as a vital component in the detection and analysis of esterase enzymes, which are essential for various biological processes.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 5-BROMO-4-CHLORO-3-INDOLYL ACETATE is used as an intermediate compound in the synthesis of various drugs. Its unique chemical properties make it a valuable building block for the development of new medications with potential therapeutic applications.
Used in Research and Development:
5-BROMO-4-CHLORO-3-INDOLYL ACETATE is also utilized in research and development for the study of enzyme kinetics, enzyme inhibition, and other biochemical processes. Its role as a substrate for esterase allows researchers to gain insights into the mechanisms of these enzymes and their potential applications in drug discovery and development.
Used in Analytical Chemistry:
In analytical chemistry, 5-BROMO-4-CHLORO-3-INDOLYL ACETATE is employed as a reagent for the detection and quantification of specific enzymes and other biomolecules. Its chemical properties make it a reliable and sensitive tool for various analytical techniques, such as high-performance liquid chromatography (HPLC) and enzyme-linked immunosorbent assay (ELISA).
Used in Environmental Applications:
5-BROMO-4-CHLORO-3-INDOLYL ACETATE can also be used in environmental applications, such as the detection and monitoring of pollutants and contaminants in water and soil samples. Its ability to interact with specific enzymes and biomolecules makes it a valuable tool for assessing the presence and impact of harmful substances in the environment.
Check Digit Verification of cas no
The CAS Registry Mumber 3252-36-6 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 3,2,5 and 2 respectively; the second part has 2 digits, 3 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 3252-36:
(6*3)+(5*2)+(4*5)+(3*2)+(2*3)+(1*6)=66
66 % 10 = 6
So 3252-36-6 is a valid CAS Registry Number.
InChI:InChI=1/C10H7BrClNO2/c1-5(14)15-8-4-13-7-3-2-6(11)10(12)9(7)8/h2-4,13H,1H3
