33225-51-3 Usage
Description
Maleic anhydride, also known as 4H-pyran-4-one-2,3-dione, is a heterocyclic compound characterized by a five-membered ring with two carbonyl groups and a double bond. It is a white crystalline solid with a strong, pungent odor. Maleic anhydride is known for its versatile chemical properties, making it a valuable intermediate in the production of various chemicals and materials.
Uses
Used in Chemical Industry:
Maleic anhydride is used as a key intermediate in the production of unsaturated polyester resins for its ability to react with alcohols to form esters, which are essential for creating strong, durable plastics and composite materials.
Used in Surfactant Production:
In the surfactant industry, maleic anhydride is used as a raw material to produce synthetic tensides, which are essential for creating detergents, soaps, and other cleaning agents. These tensides help to lower the surface tension of water, allowing for better cleaning and foaming properties.
Used in Pesticide Industry:
Maleic anhydride is used as a starting material in the synthesis of various insecticides, herbicides, and fungicides. Its chemical properties allow for the development of effective compounds that protect crops and control pests, contributing to increased agricultural productivity and food security.
Used in Pharmaceutical Industry:
As a versatile chemical intermediate, maleic anhydride is also used in the production of certain pharmaceuticals. Its ability to form esters and other derivatives makes it a valuable component in the synthesis of drugs with various therapeutic applications.
Check Digit Verification of cas no
The CAS Registry Mumber 33225-51-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,3,2,2 and 5 respectively; the second part has 2 digits, 5 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 33225-51:
(7*3)+(6*3)+(5*2)+(4*2)+(3*5)+(2*5)+(1*1)=83
83 % 10 = 3
So 33225-51-3 is a valid CAS Registry Number.
InChI:InChI=1/C4H2O3/c5-3-1-2-4(6)7-3/h1-2H/i1D,2D
