3336-39-8 Usage
Description
BROMOXYNIL-METHYL ETHER is an organic compound that serves as an important intermediate in the synthesis of various chemical compounds, particularly in the preparation of 2,5''-Disubstituted bibenzimidazoles related to Hoechst 33258. It is known for its unique chemical properties and reactivity, making it a valuable component in the development of new and innovative chemical products.
Uses
Used in Pharmaceutical Industry:
BROMOXYNIL-METHYL ETHER is used as a key intermediate in the synthesis of 2,5''-Disubstituted bibenzimidazoles, which are related to Hoechst 33258. These compounds have potential applications in the development of new drugs and therapeutic agents, particularly in the field of medicine.
Used in Chemical Research and Development:
BROMOXYNIL-METHYL ETHER is utilized in the research and development of new chemical compounds and materials. Its unique properties and reactivity make it a valuable tool for chemists and researchers working on the synthesis of novel molecules and the development of innovative products.
Check Digit Verification of cas no
The CAS Registry Mumber 3336-39-8 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 3,3,3 and 6 respectively; the second part has 2 digits, 3 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 3336-39:
(6*3)+(5*3)+(4*3)+(3*6)+(2*3)+(1*9)=78
78 % 10 = 8
So 3336-39-8 is a valid CAS Registry Number.
InChI:InChI=1/C8H5Br2NO/c1-12-8-6(9)2-5(4-11)3-7(8)10/h2-3H,1H3
