33389-33-2 Usage
General Description
1,2-Dihydro-2-(5-nitro-2-thienyl)quinazoline-4-one is a chemical compound with the molecular formula C14H10N4O3S. It is a quinazoline derivative with a nitrogen atom, two carbon atoms, and a thienyl group attached to the quinazoline ring. The compound also contains a nitro group on the thienyl group. It is a yellow solid with potential biological activity, and it may have applications in pharmaceutical research, particularly in the development of new drugs for various medical conditions. Its specific properties and potential uses would need to be determined through further research and testing.
Check Digit Verification of cas no
The CAS Registry Mumber 33389-33-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,3,3,8 and 9 respectively; the second part has 2 digits, 3 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 33389-33:
(7*3)+(6*3)+(5*3)+(4*8)+(3*9)+(2*3)+(1*3)=122
122 % 10 = 2
So 33389-33-2 is a valid CAS Registry Number.
InChI:InChI=1/C12H9N3O3S/c16-12-7-3-1-2-4-8(7)13-11(14-12)9-5-6-10(19-9)15(17)18/h1-6,11,13H,(H,14,16)
