33632-74-5 Usage
General Description
3,4-Dihydro-2H-1,5-benzodioxepine-7-carboxylic acid is a chemical compound with the molecular formula C11H10O5. It is a carboxylic acid derivative of benzodioxepine, a heterocyclic compound with a fused benzene and dioxepine ring system. This chemical is used in various pharmaceutical and medical applications, particularly in the development of psychoactive drugs and as a starting material for the synthesis of other organic compounds. Its specific properties and potential uses depend on the functional groups and substitutions on the benzodioxepine structure, and it is typically handled and stored in compliance with standard laboratory safety protocols.
Check Digit Verification of cas no
The CAS Registry Mumber 33632-74-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,3,6,3 and 2 respectively; the second part has 2 digits, 7 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 33632-74:
(7*3)+(6*3)+(5*6)+(4*3)+(3*2)+(2*7)+(1*4)=105
105 % 10 = 5
So 33632-74-5 is a valid CAS Registry Number.
InChI:InChI=1/C10H10O4/c11-10(12)7-2-3-8-9(6-7)14-5-1-4-13-8/h2-3,6H,1,4-5H2,(H,11,12)