3371-85-5 Usage
Description
Methyl 12-methoxy-13-(17-methoxy-17-oxovobasan-3alpha-yl)ibogamine-18-carboxylate is a complex organic compound derived from the iboga plant, which is known for its various pharmacological properties. It is characterized by its unique chemical structure, which includes multiple functional groups such as methoxy, oxo, and carboxylate moieties. These structural features contribute to its potential applications in various fields.
Uses
Used in Pharmaceutical Applications:
Methyl 12-methoxy-13-(17-methoxy-17-oxovobasan-3alpha-yl)ibogamine-18-carboxylate is used as a pharmaceutical agent for its potential therapeutic effects. methyl 12-methoxy-13-(17-methoxy-17-oxovobasan-3alpha-yl)ibogamine-18-carboxylate's unique structure allows it to interact with specific biological targets, making it a promising candidate for the development of new drugs.
Used in Anticancer Applications:
In the field of oncology, methyl 12-methoxy-13-(17-methoxy-17-oxovobasan-3alpha-yl)ibogamine-18-carboxylate is used as an anticancer agent. It may exhibit inhibitory effects on tumor growth and progression by targeting specific cellular pathways involved in cancer development.
Used in Drug Delivery Systems:
Methyl 12-methoxy-13-(17-methoxy-17-oxovobasan-3alpha-yl)ibogamine-18-carboxylate can also be used in the development of drug delivery systems. Its chemical structure may allow for the design of novel carriers or formulations that improve the bioavailability and therapeutic efficacy of other drugs, particularly in the treatment of cancer.
Used in Antileishmanial Applications:
Methyl 12-methoxy-13-(17-methoxy-17-oxovobasan-3alpha-yl)ibogamine-18-carboxylate is used as an antileishmanial agent, targeting the bi-subunit topoisomerase IB in Leishmania parasites. This activity may contribute to its potential use in the treatment of leishmaniasis, a disease caused by these parasites.
Check Digit Verification of cas no
The CAS Registry Mumber 3371-85-5 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 3,3,7 and 1 respectively; the second part has 2 digits, 8 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 3371-85:
(6*3)+(5*3)+(4*7)+(3*1)+(2*8)+(1*5)=85
85 % 10 = 5
So 3371-85-5 is a valid CAS Registry Number.
InChI:InChI=1/C43H52N4O5/c1-7-24-15-23-20-43(42(49)52-6)39-27(13-14-47(21-23)40(24)43)29-19-36(50-4)30(17-34(29)45-39)31-16-28-25(8-2)22-46(3)35(37(28)41(48)51-5)18-32-26-11-9-10-12-33(26)44-38(31)32/h8-12,17,19,23-24,28,31,35,37,40,44-45H,7,13-16,18,20-22H2,1-6H3/b25-8-/t23-,24-,28-,31+,35+,37?,40-,43+/m0/s1