339016-33-0 Usage
General Description
2-[1-(3-chlorobenzyl)-1H-indol-3-yl]acetic acid is a chemical compound that belongs to the class of indole derivatives. It is a derivative of indole-3-acetic acid, a plant hormone that plays a crucial role in the regulation of plant growth and development. The presence of a chlorobenzyl group in the molecule enhances its pharmacological properties, making it potentially useful in medicinal chemistry. 2-[1-(3-CHLOROBENZYL)-1H-INDOL-3-YL]ACETIC ACID may have anti-inflammatory, analgesic, or other biological activities that are yet to be fully explored. It is an important compound in the field of organic synthesis and medicinal research due to its unique structure and potential pharmacological properties.
Check Digit Verification of cas no
The CAS Registry Mumber 339016-33-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,3,9,0,1 and 6 respectively; the second part has 2 digits, 3 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 339016-33:
(8*3)+(7*3)+(6*9)+(5*0)+(4*1)+(3*6)+(2*3)+(1*3)=130
130 % 10 = 0
So 339016-33-0 is a valid CAS Registry Number.
InChI:InChI=1/C17H14ClNO2/c18-14-5-3-4-12(8-14)10-19-11-13(9-17(20)21)15-6-1-2-7-16(15)19/h1-8,11H,9-10H2,(H,20,21)
