339528-39-1 Usage
General Description
7-Chloro-imidazo[1,2-b]pyridazine-2-carboxylic acid is a chemical compound with the molecular formula C8H5ClN4O2. It is a pyridazine derivative with a chlorine atom attached to the imidazole ring. 7-CHLORO-IMIDAZO[1,2-B]PYRIDAZINE-2-CARBOXYLIC ACID has potential applications in medicinal chemistry, as it may exhibit biological activity and has been studied for its potential as a pharmaceutical ingredient. The carboxylic acid group makes it a potential candidate for drug design and chemical synthesis. Its structure and properties make it an interesting chemical for further investigation and potential use in the development of new drugs or other biologically active compounds.
Check Digit Verification of cas no
The CAS Registry Mumber 339528-39-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,3,9,5,2 and 8 respectively; the second part has 2 digits, 3 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 339528-39:
(8*3)+(7*3)+(6*9)+(5*5)+(4*2)+(3*8)+(2*3)+(1*9)=171
171 % 10 = 1
So 339528-39-1 is a valid CAS Registry Number.
InChI:InChI=1/C7H4ClN3O2/c8-4-1-6-10-5(7(12)13)3-11(6)9-2-4/h1-3H,(H,12,13)