3400-55-3 Usage
Description
2-BROMOPRIOPIONALDEHYDE DIETHYL ACETAL is an organic compound that is the 2-bromo derivative of Propionaldehyde diethyl acetal (P827700). It is characterized by its unique chemical structure, which includes a bromo group and a diethyl acetal functional group. 2-BROMOPRIOPIONALDEHYDE DIETHYL ACETAL is known for its reactivity and potential applications in various chemical and pharmaceutical processes.
Uses
Used in Pharmaceutical Industry:
2-BROMOPRIOPIONALDEHYDE DIETHYL ACETAL is used as a reagent for the synthesis of piperazinylimidazo[1,2-a]pyrazines. These compounds exhibit selective affinity for α-adrenergic receptor subtypes, making them valuable in the development of drugs targeting these receptors. The α-adrenergic receptors play a crucial role in various physiological processes, and their modulation can be beneficial in treating conditions such as hypertension, anxiety, and other related disorders.
Used in Chemical Synthesis:
In the field of chemical synthesis, 2-BROMOPRIOPIONALDEHYDE DIETHYL ACETAL can be employed as an intermediate or building block for the creation of more complex molecules. Its unique structure allows for various chemical reactions, such as substitution, addition, and condensation, which can lead to the formation of novel compounds with potential applications in different industries, including pharmaceuticals, agrochemicals, and materials science.
Check Digit Verification of cas no
The CAS Registry Mumber 3400-55-3 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 3,4,0 and 0 respectively; the second part has 2 digits, 5 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 3400-55:
(6*3)+(5*4)+(4*0)+(3*0)+(2*5)+(1*5)=53
53 % 10 = 3
So 3400-55-3 is a valid CAS Registry Number.
InChI:InChI=1/C7H15BrO2/c1-4-9-7(6(3)8)10-5-2/h6-7H,4-5H2,1-3H3
3400-55-3Relevant articles and documents
-
Marvell,Joncich
, p. 973 (1951)
-
PREPARATION AND SYNTHETIC UTILIZATION OF 3-(ADENIN-9-YL)-2-HYDROXYALKANOIC ACIDS AND THEIR DERIVATIVES
Holy, Antonin
, p. 2148 - 2166 (2007/10/02)
Condensation of adenine and its substituted derivatives with 1,1-dialkoxy-2-bromoalkanes afforded substituted 2-(adenin-9-yl)-1,1-dialkoxyalkanes I and IV.Acid hydrolysis of I or IV, followed by reaction with alkali metal cyanides and acid hydrolysis, gave substituted 3-(adenin-9-yl)-2-hydroxyalkanoic acids II, V and VI.Methyl esters of these compounds (VIII) were converted into 3-(adenin-9-yl)alkane-1,2-diols IX by reduction with sodium borohydride. 3-(Adenin-9-yl)-2-methoxypropanoic acid (XVII) was obtained by oxidation of 9-(3-hydroxy-2-methoxypropyl)adenine (XVI)with sodium periodate; 4-(adenin-9-yl)-2-(S)-hydroxybutanoic acid (XXVII) was synthesized by oxidation of 9-(S)-(2-tetrahydropyranyloxy-4-hydroxybutyl)adenine (XXV), prepared from diethyl L-malate.Acid hydrolysis of XXV afforded 9-(S)-(2,4-dihydroxybutyl)adenine (XXVI). 4-(Adenin-9-yl)-3-hydroxypentanoic acid (XXIX) was obtained by reaction of malonic acid with 2-(adenin-9-yl)-1,1-diethoxypropane (IVa) in water.
