34276-26-1 Usage
General Description
N(alpha)-acetylarginine methylamide is a chemical compound that consists of a molecule of N(alpha)-acetylarginine, which is a derivative of the amino acid arginine, connected to a methylamide group. N(alpha)-acetylarginine methylamide is often used in biochemical and molecular biology research as a substrate for enzymes involved in arginine metabolism. N(alpha)-acetylarginine methylamide has been implicated in various cellular processes, including protein synthesis, nitric oxide production, and the regulation of cellular energy metabolism. It also plays a role in the synthesis of creatine, an important compound for muscle energy metabolism. Additionally, N(alpha)-acetylarginine methylamide has potential applications in the development of new pharmaceuticals targeting arginine-related pathways.
Check Digit Verification of cas no
The CAS Registry Mumber 34276-26-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,4,2,7 and 6 respectively; the second part has 2 digits, 2 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 34276-26:
(7*3)+(6*4)+(5*2)+(4*7)+(3*6)+(2*2)+(1*6)=111
111 % 10 = 1
So 34276-26-1 is a valid CAS Registry Number.
InChI:InChI=1/C9H19N5O2/c1-6(15)14-7(8(16)12-2)4-3-5-13-9(10)11/h7H,3-5H2,1-2H3,(H,12,16)(H,14,15)(H4,10,11,13)/t7-/m0/s1