3435-25-4 Usage
Description
4-METHYL-6-CHLORO PYRIMIDINE is an organic compound that serves as a crucial intermediate in the synthesis of various chemical and pharmaceutical products. It is characterized by its unique molecular structure, which features a methyl group at the 4th position and a chlorine atom at the 6th position on the pyrimidine ring. 4-METHYL-6-CHLORO PYRIMIDINE is known for its versatility in chemical reactions and its potential applications in different industries.
Uses
Used in Organic Synthesis:
4-METHYL-6-CHLORO PYRIMIDINE is used as a key intermediate for the synthesis of various organic compounds. Its unique structure allows for a wide range of chemical reactions, making it a valuable building block in the development of new molecules with specific properties and functions.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 4-METHYL-6-CHLORO PYRIMIDINE is used as a starting material for the development of new drugs. Its chemical properties enable the creation of diverse drug candidates with potential therapeutic applications, including the treatment of various diseases and medical conditions.
Used in Agrochemicals:
4-METHYL-6-CHLORO PYRIMIDINE is also utilized in the agrochemical industry as a precursor for the synthesis of various pesticides and other agricultural chemicals. Its incorporation into these products can help improve their effectiveness in controlling pests and diseases, ultimately contributing to increased crop yields and food security.
Used in Dyestuffs:
In the dyestuffs industry, 4-METHYL-6-CHLORO PYRIMIDINE is employed as a raw material for the production of various types of dyes. Its unique chemical structure allows for the creation of dyes with specific color properties, which can be used in a wide range of applications, from textiles to printing and painting.
Check Digit Verification of cas no
The CAS Registry Mumber 3435-25-4 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 3,4,3 and 5 respectively; the second part has 2 digits, 2 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 3435-25:
(6*3)+(5*4)+(4*3)+(3*5)+(2*2)+(1*5)=74
74 % 10 = 4
So 3435-25-4 is a valid CAS Registry Number.
InChI:InChI=1/C5H5ClN2/c1-4-2-5(6)8-3-7-4/h2-3H,1H3
3435-25-4Relevant articles and documents
Suzuki-Miyaura and Negishi approaches to a series of forensically relevant pyridines and pyrimidines
Blachut, Dariusz,Szawkalo, Joanna,Czarnocki, Zbigniew
experimental part, p. 3496 - 3506 (2011/12/04)
A library of 5-aryl-4-methylpyrimidines, phenyl ring-substituted derivatives of 4-benzylpyrimidines, 2,6-benzylpyridines, and 2,6-dibenzyl-4-methylpyridines were prepared. The synthesis of 5-aryl-4-methylpyrimidines was accomplished by Suzuki-Miyaura cross-coupling reaction between arylboronic acids and 5-bromo-4-methylpyrimidine. The 4-benzylpyrimidines and 2,6-benzylpyridines were synthesized by treatment of 4-bromopyrimidine and 2,6-dibromopyridine derivatives with ring-substituted benzylzinc reagents. Georg Thieme Verlag Stuttgart.
