34424-15-2 Usage
General Description
(+)-DI-MU-CHLOROBIS(2-(1-(DIMETHYLAMINO)-ETHYL)PHENYL-C,N)DIPALLADIUM, 98 is a chemical compound that is made up of two palladium atoms bound together by two chlorine atoms and a bridge of a phenyl group connected to a dimethylaminoethyl group. It is a highly pure chemical, with a 98% level of purity. (+)-DI-MU-CHLOROBIS(2-(1-(DIMETHYLAMINO)-ETHYL)PHENYL-C,N)DIPALLADIUM, 98 has potential uses in chemical synthesis and catalysis due to the presence of palladium, which is known for its ability to catalyze various organic reactions. Additionally, the specific structure of this compound may lend itself to unique reactivity and selectivity in certain chemical transformations.
Check Digit Verification of cas no
The CAS Registry Mumber 34424-15-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,4,4,2 and 4 respectively; the second part has 2 digits, 1 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 34424-15:
(7*3)+(6*4)+(5*4)+(4*2)+(3*4)+(2*1)+(1*5)=92
92 % 10 = 2
So 34424-15-2 is a valid CAS Registry Number.
InChI:InChI=1/C20H26N2.2ClH.2Pd/c1-15(21(3)4)17-9-7-11-19(13-17)20-12-8-10-18(14-20)16(2)22(5)6;;;;/h7-12,15-16H,1-6H3;2*1H;;/q;;;2*+1/p-2/t15-,16+;;;;/rC20H26Cl2N2Pd2/c1-13-15-9-7-11-17(19(15)25(21)23(13,3)4)18-12-8-10-16-14(2)24(5,6)26(22)20(16)18/h7-14H,1-6H3/t13-,14+