3458-98-8 Usage
Description
3-HYDROXYPHENETHYLAMINE HYDROCHLORIDE, also known as m-Tyramine Hydrochloride, is an organic compound with a hydroxyl group and an amine group attached to a phenethylamine backbone. It is characterized by its ability to influence the firing pattern of certain organisms and has potential applications in various fields due to its unique properties.
Uses
Used in Pharmaceutical Industry:
3-HYDROXYPHENETHYLAMINE HYDROCHLORIDE is used as a potential organ or tumor imaging agent for its ability to affect the firing pattern of Heobania vermiculata. This property makes it a promising candidate for the development of new diagnostic tools and imaging techniques in the field of medicine, particularly for detecting and monitoring the progression of various diseases and conditions.
Used in Research Applications:
In the field of scientific research, 3-HYDROXYPHENETHYLAMINE HYDROCHLORIDE serves as a valuable compound for studying the mechanisms and pathways involved in the firing patterns of certain organisms. This can lead to a better understanding of the underlying processes and potentially contribute to the development of new therapeutic strategies for various conditions.
Used in Chemical Synthesis:
3-HYDROXYPHENETHYLAMINE HYDROCHLORIDE can also be utilized as a starting material or intermediate in the synthesis of other complex organic compounds. Its unique structure and functional groups make it a versatile building block for the creation of novel molecules with potential applications in various industries, including pharmaceuticals, agrochemicals, and materials science.
Check Digit Verification of cas no
The CAS Registry Mumber 3458-98-8 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 3,4,5 and 8 respectively; the second part has 2 digits, 9 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 3458-98:
(6*3)+(5*4)+(4*5)+(3*8)+(2*9)+(1*8)=108
108 % 10 = 8
So 3458-98-8 is a valid CAS Registry Number.
InChI:InChI=1/C8H11NO.ClH/c9-5-4-7-2-1-3-8(10)6-7;/h1-3,6,10H,4-5,9H2;1H
3458-98-8Relevant articles and documents
SUBSTITUTED HYDROXYPHENYLAMINE COMPOUNDS
-
Page/Page column 45, (2010/06/11)
The present invention relates to new substituted hydroxyphenylamine based modulators of hormone and/or pigment levels, pharmaceutical compositions thereof, and methods of use thereof. Formula (I).
Regioselective synthesis of 6-fluorodopamine, 6-fluoro-m-tyramine and 4-fluoro-m-tyramine using elemental fluorine, oxygen difluoride and acetyl hypofluorite
Namavari, Mohammad,Satyamurthy, N.,Barrio, Jorge R.
, p. 113 - 122 (2007/10/03)
6-Fluorodopamine was regioselectively synthesized in good yields from N-(trifluoroacetyl)-3,4-di-t-butoxycarbonyloxy-6-(trimethylstannyl)phenylethylamine (6) via a fluorodestannylation reaction using F2, OF2 or CH3COOF followed by acid hydrolysis.Similarly, 6-fluoro-m-tyramine (14) and 4-fluoro-m-tyramine (20) were prepared from their corresponding trimethylstannyl derivatives.All precursors and products were fully characterized by multinuclear NMR spectroscopy and high resolution mass spectrometry. - Keywords: Dopamine neurotransmission; Norepinephrine synthesis; Dopamine agonist; 6-fluorodopamine; Fluorodestannylation
