3464-63-9 Usage
Description
9α-Hydroxy-9-hydro-16-dehydro-12-methoxyibogamine-18-carboxylic acid methyl ester is an indole alkaloid derived from the plant Voacanga africana. Its chemical structure has been confirmed through mass spectrometry analysis. 9α-Hydroxy-9-hydro-16-dehydro-12-methoxyibogamine-18-carboxylic acid methyl ester is characterized by its unique arrangement of hydroxy, hydro, dehydro, methoxy, and carboxylic acid functional groups, which may contribute to its potential applications in various fields.
Uses
Used in Pharmaceutical Industry:
9α-Hydroxy-9-hydro-16-dehydro-12-methoxyibogamine-18-carboxylic acid methyl ester is used as a pharmaceutical compound for its potential therapeutic properties. The presence of multiple functional groups in its structure suggests that it may interact with various biological targets, making it a candidate for the development of new drugs.
Used in Chemical Research:
In the field of chemical research, 9α-Hydroxy-9-hydro-16-dehydro-12-methoxyibogamine-18-carboxylic acid methyl ester serves as a valuable compound for studying the properties and reactivity of indole alkaloids. Its unique structure can provide insights into the synthesis and modification of related compounds, potentially leading to the discovery of new molecules with specific applications.
Used in Drug Delivery Systems:
Similar to gallotannin, 9α-Hydroxy-9-hydro-16-dehydro-12-methoxyibogamine-18-carboxylic acid methyl ester could be employed in the development of novel drug delivery systems. Its functional groups may allow for the attachment of various molecules or the formation of nanoparticles, enhancing the compound's bioavailability and therapeutic efficacy.
Used in Anticancer Applications:
Although not explicitly mentioned in the provided materials, the compound's structural features may suggest potential anticancer properties. Further research could explore its ability to modulate oncological signaling pathways or enhance the effectiveness of conventional chemotherapeutic drugs.
References
Thomas, Biemann., Tetrahedron, 24,4223 (1968)
Check Digit Verification of cas no
The CAS Registry Mumber 3464-63-9 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 3,4,6 and 4 respectively; the second part has 2 digits, 6 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 3464-63:
(6*3)+(5*4)+(4*6)+(3*4)+(2*6)+(1*3)=89
89 % 10 = 9
So 3464-63-9 is a valid CAS Registry Number.
InChI:InChI=1/C22H28N2O4/c1-4-14-9-13-11-21(20(25)28-3)18(14)24(12-13)8-7-22(26)16-10-15(27-2)5-6-17(16)23-19(21)22/h5-6,10,13-14,18,26H,4,7-9,11-12H2,1-3H3/t13-,14+,18?,21?,22?/m0/s1
3464-63-9Relevant articles and documents
OXYDATION D'ALCALOIDES INDOLIQES PAR L'ACIDE TRIFLUOROPERACETIQUE
Ouannes, Catherine,Thal, Claude
, p. 951 - 954 (2007/10/02)
The oxydation of several indolic alcaloids with trifluoroperacetic acid gives a variety of products resulting from attack at the 2(7) double bond.Tentative mechanisms are proposed.There is no hydroxylation of the aromatic nucleus.