34749-22-9 Usage
Description
ETHYL 10-(B-CHLOROPROPIONYL)PHENOTHIAZINE-2-CARBAMATE is a chemical compound belonging to the phenothiazine class, characterized by a molecular formula of C21H19ClN2O2S. It features a carbamate functional group and a chloropropionyl substituent, which may confer it with potential pharmacological properties similar to other phenothiazine derivatives known for their antipsychotic, antiemetic, and sedative effects. Further research is required to ascertain its specific characteristics and applications.
Uses
Used in Pharmaceutical Industry:
ETHYL 10-(B-CHLOROPROPIONYL)PHENOTHIAZINE-2-CARBAMATE is used as a potential pharmaceutical agent for its possible antipsychotic, antiemetic, and sedative effects due to its structural similarity to other phenothiazine derivatives. Its carbamate functional group and chloropropionyl substituent may contribute to its therapeutic potential, although further research is needed to confirm its efficacy and safety in clinical settings.
Used in Chemical Research:
In the field of chemical research, ETHYL 10-(B-CHLOROPROPIONYL)PHENOTHIAZINE-2-CARBAMATE serves as a subject for investigation to explore its chemical properties, reactivity, and potential for synthesis in various chemical processes. Understanding its behavior in different environments can lead to the development of new applications and uses in both pharmaceutical and industrial settings.
Check Digit Verification of cas no
The CAS Registry Mumber 34749-22-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,4,7,4 and 9 respectively; the second part has 2 digits, 2 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 34749-22:
(7*3)+(6*4)+(5*7)+(4*4)+(3*9)+(2*2)+(1*2)=129
129 % 10 = 9
So 34749-22-9 is a valid CAS Registry Number.
InChI:InChI=1/C18H17ClN2O3S/c1-2-24-18(23)20-12-7-8-16-14(11-12)21(17(22)9-10-19)13-5-3-4-6-15(13)25-16/h3-8,11H,2,9-10H2,1H3,(H,20,23)