348098-29-3 Usage
General Description
2-(Methylthio)pyrimidine-5-boronic acid is a chemical compound with the molecular formula C6H7BN2OS. It is a boronic acid derivative of the pyrimidine compound, containing a boron atom attached to the pyrimidine ring. 2-(METHYLTHIO)PYRIMIDINE-5-BORONIC ACID is commonly used as a building block in organic synthesis and medicinal chemistry, particularly in the development of pharmaceuticals and agrochemicals. Its boronic acid moiety allows it to be used in Suzuki coupling reactions to form carbon-carbon bonds, making it a versatile tool in the synthesis of complex organic molecules. 2-(Methylthio)pyrimidine-5-boronic acid is also known for its potential as a ligand in organometallic chemistry and as a substrate for enzyme-catalyzed reactions.
Check Digit Verification of cas no
The CAS Registry Mumber 348098-29-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,4,8,0,9 and 8 respectively; the second part has 2 digits, 2 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 348098-29:
(8*3)+(7*4)+(6*8)+(5*0)+(4*9)+(3*8)+(2*2)+(1*9)=173
173 % 10 = 3
So 348098-29-3 is a valid CAS Registry Number.
InChI:InChI=1/C5H7BN2O2S/c1-11-5-7-2-4(3-8-5)6(9)10/h2-3,9-10H,1H3
348098-29-3Relevant articles and documents
NOVEL COMPOUNDS AS GPR119 AGONISTS
-
Paragraph 0499-0501, (2017/10/26)
The present invention relates to novel compounds of formula (I) as GPR119 agonist, composition compositions containing such compounds and method of preparation thereof.
