34911-62-1 Usage
General Description
4-OXOHEPTA-2,5-DIENEDIOIC ACID is a chemical compound with the molecular formula C7H6O5. It is a derivative of maleic acid and belongs to the class of carboxylic acids. It is a white crystalline solid that is soluble in water and has a melting point of 220-222°C. 4-OXOHEPTA-2,5-DIENEDIOIC ACID is used in the synthesis of various pharmaceuticals and organic compounds, and it has potential applications in the field of organic chemistry and chemical research. Additionally, 4-OXOHEPTA-2,5-DIENEDIOIC ACID is also known for its ability to chelate metal ions, making it useful in applications such as metal extraction and as a sequestering agent in water treatment processes. Overall, this compound has a range of potential uses in various industries and research fields.
Check Digit Verification of cas no
The CAS Registry Mumber 34911-62-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,4,9,1 and 1 respectively; the second part has 2 digits, 6 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 34911-62:
(7*3)+(6*4)+(5*9)+(4*1)+(3*1)+(2*6)+(1*2)=111
111 % 10 = 1
So 34911-62-1 is a valid CAS Registry Number.
InChI:InChI=1/C7H6O5/c8-5(1-3-6(9)10)2-4-7(11)12/h1-4H,(H,9,10)(H,11,12)/b3-1+,4-2+