3519-82-2 Usage
Description
9,10-DIHYDRO-9,10[1',2']-BENZENOANTHRACENE-1,4-DIONE is a chemical compound with a complex molecular structure, characterized by its dihydro and benzenoanthracene components. It is known for its potential applications in various fields due to its unique properties.
Uses
Used in Pharmaceutical Industry:
9,10-DIHYDRO-9,10[1',2']-BENZENOANTHRACENE-1,4-DIONE is used as a research compound for studying its interactions with biological systems and exploring its potential therapeutic applications. Its unique molecular structure allows it to be investigated for possible roles in drug development and targeting specific biological pathways.
Used in Chemical Research:
In the field of chemical research, 9,10-DIHYDRO-9,10[1',2']-BENZENOANTHRACENE-1,4-DIONE serves as a valuable compound for understanding its reactivity, stability, and potential use in the synthesis of other complex molecules. Its properties can be harnessed to develop new materials or improve existing ones.
Used in Material Science:
9,10-DIHYDRO-9,10[1',2']-BENZENOANTHRACENE-1,4-DIONE may be utilized in material science to develop new materials with specific properties, such as improved conductivity, strength, or chemical resistance. Its unique structure can contribute to the advancement of materials with tailored characteristics for various applications.
Biological Activity
Inhibitor of interaction between calcineurin and its substrate nuclear factor of activated T cells (NFAT); blocks at the substrate recognition site but not at the catalytic site (K d = 0.8 mM). Inhibits NFAT dephosphorylation and nuclear import. Also prevents induction of cytokine mRNAs that are downstream targets of NFAT.
Biochem/physiol Actions
Cell permeable: yes
Check Digit Verification of cas no
The CAS Registry Mumber 3519-82-2 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 3,5,1 and 9 respectively; the second part has 2 digits, 8 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 3519-82:
(6*3)+(5*5)+(4*1)+(3*9)+(2*8)+(1*2)=92
92 % 10 = 2
So 3519-82-2 is a valid CAS Registry Number.
InChI:InChI=1/C20H12O2/c21-15-9-10-16(22)20-18-12-6-2-1-5-11(12)17(19(15)20)13-7-3-4-8-14(13)18/h1-10,17-18H