352530-36-0 Usage
Description
(2-Chloro-5-pyridyl)methylzinc chloride is an organozinc reagent that is highly reactive and versatile in organic synthesis. It can be used in various chemical reactions, such as cross-coupling reactions and addition reactions. As a nucleophilic organozinc reagent, it can react with a wide range of electrophiles, making it a valuable tool in the construction of complex organic molecules. Its ability to form carbon-carbon bonds and carbon-heteroatom bonds makes it a valuable building block in the synthesis of pharmaceuticals, agrochemicals, and other fine chemicals. However, due to its sensitivity to moisture and air, it is typically handled and stored under an inert atmosphere.
Uses
Used in Pharmaceutical Industry:
(2-Chloro-5-pyridyl)methylzinc chloride is used as a building block for the synthesis of complex organic molecules in the pharmaceutical industry. Its ability to form carbon-carbon bonds and carbon-heteroatom bonds makes it a valuable tool in the development of new drugs and pharmaceutical compounds.
Used in Agrochemical Industry:
(2-Chloro-5-pyridyl)methylzinc chloride is used as a building block for the synthesis of complex organic molecules in the agrochemical industry. Its versatility in forming carbon-carbon bonds and carbon-heteroatom bonds makes it a valuable tool in the development of new agrochemicals and pesticides.
Used in Fine Chemicals Industry:
(2-Chloro-5-pyridyl)methylzinc chloride is used as a building block for the synthesis of complex organic molecules in the fine chemicals industry. Its reactivity and ability to form various types of bonds make it a valuable tool in the production of specialty chemicals and intermediates for various applications.
Check Digit Verification of cas no
The CAS Registry Mumber 352530-36-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,5,2,5,3 and 0 respectively; the second part has 2 digits, 3 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 352530-36:
(8*3)+(7*5)+(6*2)+(5*5)+(4*3)+(3*0)+(2*3)+(1*6)=120
120 % 10 = 0
So 352530-36-0 is a valid CAS Registry Number.
InChI:InChI=1/C6H5ClN.ClH.Zn/c1-5-2-3-6(7)8-4-5;;/h2-4H,1H2;1H;/q;;+1/p-1/rC6H5Cl2NZn/c7-6-2-1-5(3-9-6)4-10-8/h1-3H,4H2
