3530-14-1 Usage
Description
Hydroxyacetic Acid Hydrazide, with the CAS number 3530-14-1, is a white crystalline solid that serves as a versatile compound in the realm of organic synthesis. Its unique chemical structure allows it to be a valuable building block for the creation of various complex organic molecules.
Uses
Used in Organic Synthesis:
Hydroxyacetic Acid Hydrazide is used as a synthetic building block for the development of a wide range of organic compounds. Its ability to form diverse chemical bonds and participate in multiple reactions makes it a valuable asset in the synthesis of pharmaceuticals, agrochemicals, and other specialty chemicals.
Used in Pharmaceutical Industry:
Hydroxyacetic Acid Hydrazide is used as an intermediate in the synthesis of various pharmaceutical compounds. Its versatility in forming different types of chemical bonds allows for the creation of a broad spectrum of therapeutic agents, contributing to the advancement of drug discovery and development.
Used in Agrochemical Industry:
Hydroxyacetic Acid Hydrazide is employed as a key component in the synthesis of agrochemicals, such as pesticides and herbicides. Its role in creating complex organic molecules enables the development of more effective and targeted products for agricultural applications.
Used in Specialty Chemicals:
Hydroxyacetic Acid Hydrazide is utilized as a starting material for the production of specialty chemicals, which find applications in various industries, including cosmetics, dyes, and coatings. Its unique properties and reactivity contribute to the creation of innovative and high-performance products in these sectors.
Check Digit Verification of cas no
The CAS Registry Mumber 3530-14-1 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 3,5,3 and 0 respectively; the second part has 2 digits, 1 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 3530-14:
(6*3)+(5*5)+(4*3)+(3*0)+(2*1)+(1*4)=61
61 % 10 = 1
So 3530-14-1 is a valid CAS Registry Number.
InChI:InChI=1/C2H6N2O2/c3-4-2(6)1-5/h5H,1,3H2,(H,4,6)