35911-17-2 Usage
Description
1,3-Dibromo-2-methyl-1-propene is an organic compound with the chemical formula C4H6Br2. It is a colorless to pale yellow liquid with a characteristic odor. 1,3-Dibromo-2-methyl-1-propene is known for its reactivity and is commonly used as an intermediate in the synthesis of various organic compounds.
Uses
1. Used in Organic Synthesis:
1,3-Dibromo-2-methyl-1-propene is used as a synthetic intermediate for the production of various organic compounds. Its reactivity allows for the formation of new chemical bonds, making it a valuable building block in the creation of complex molecules.
2. Used in Pharmaceutical Industry:
In the pharmaceutical industry, 1,3-Dibromo-2-methyl-1-propene is used as a key component in the synthesis of certain drugs. Its unique structure and reactivity enable the development of new medications with potential therapeutic applications.
3. Used in Chemical Research:
1,3-Dibromo-2-methyl-1-propene is also utilized in chemical research as a model compound for studying various reaction mechanisms and exploring new synthetic pathways. This helps researchers gain a deeper understanding of organic chemistry and develop innovative methods for creating novel compounds.
4. Used in Material Science:
In the field of material science, 1,3-Dibromo-2-methyl-1-propene can be used to develop new materials with specific properties. Its incorporation into polymers or other materials can lead to the creation of materials with enhanced characteristics, such as improved stability or reactivity.
Check Digit Verification of cas no
The CAS Registry Mumber 35911-17-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,5,9,1 and 1 respectively; the second part has 2 digits, 1 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 35911-17:
(7*3)+(6*5)+(5*9)+(4*1)+(3*1)+(2*1)+(1*7)=112
112 % 10 = 2
So 35911-17-2 is a valid CAS Registry Number.
InChI:InChI=1/C4H6Br2/c1-4(2-5)3-6/h2H,3H2,1H3
35911-17-2Relevant articles and documents
AN EXAMPLE OF A CONCERTED TRANS - ADDITION OF Br2 TO A DOUBLE BOND
Nesmeyanova, O. A.,Kudryatseva, G. A.
, p. 2324 (1982)
-
Stereoselective synthesis of 2-dienyl-substituted pyrrolidines using an η4-dienetricarbonyliron complex as the stereodirecting element: Elaboration to the pyrrolizidine skeleton
Williams, Iwan,Kariuki, Benson M.,Reeves, Keith,Cox, Liam R.
, p. 4389 - 4392 (2007/10/03)
Primary amines react with keto-aldehyde functionality located in the side-chain of an η4-dienetricarbonyliron complex to provide the corresponding pyrrolidines in excellent diastereoselectivity. Two of the pyrrolidine products, 1i and 1k, have been elaborated into pyrrolizidines using a 1,5-C-H insertion and radical cyclization strategy, respectively.
