3638-98-0 Usage
General Description
2,4,6-Trichlorobenzene-1,3,5-tricarbonitrile (IUPAC name) is a complex organic compound characterized by the presence of a benzene ring substituted with three chlorine atoms and three nitrile functional groups. This chemical structure suggests that it may exhibit properties similar to other halogenated aromatic compounds and nitriles, which are often used in the manufacture of various polymers due because of their reactivity and stability. However, detailed information about its specific uses, properties as well as safety and environmental benchmarks are sparse and may require further investigation. Additionally, due to its highly specific chemical structure, it is likely that this compound is used primarily in specialized or niche applications.
Check Digit Verification of cas no
The CAS Registry Mumber 3638-98-0 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 3,6,3 and 8 respectively; the second part has 2 digits, 9 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 3638-98:
(6*3)+(5*6)+(4*3)+(3*8)+(2*9)+(1*8)=110
110 % 10 = 0
So 3638-98-0 is a valid CAS Registry Number.
InChI:InChI=1/C9Cl3N3/c10-7-4(1-13)8(11)6(3-15)9(12)5(7)2-14
