3652-14-0 Usage
Properties
1. Chemical Name: 2-Acetylamino-5-(4-pyridyl)-1,3,4-thiadiazole
2. Abbreviation: APD
3. Chemical Structure:
APD is a derivative of 1,3,4-thiadiazole containing a pyridyl group.
4. Pharmacological Potential:
APD is being investigated for its pharmacological properties.
5. Target Enzyme:
Selective inhibitor of monoamine oxidase A (MAO-A).
6. Neurological Disorders:
Potential for treating conditions like depression and Parkinson's disease.
7. Antimicrobial Activity:
Exhibits antimicrobial activity against certain bacteria and fungi.
Specific Content
1. Chemical Structure Details:
APD contains an acetylamino group (NHCOCH3), a pyridyl group (C5H4N), and a 1,3,4-thiadiazole ring.
2. Pharmacological Mechanism:
Works by selectively inhibiting MAO-A, which regulates neurotransmitters in the brain.
3. Preclinical Studies:
Demonstrated promising properties in preclinical studies.
4. Neurological Disorders Treatment:
Shows potential for treating depression and Parkinson's disease.
5. Antimicrobial Activity:
Effective against specific bacteria and fungi.
6. Research and Development Interest:
Considered a compound of interest for further research and development in neuroscience and antimicrobial therapy.
These properties and specific content highlight the potential of 2-Acetylamino-5-(4-pyridyl)-1,3,4-thiadiazole (APD) in both neurological disorder treatment and antimicrobial therapy, making it a compound worth further investigation and development.
Check Digit Verification of cas no
The CAS Registry Mumber 3652-14-0 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 3,6,5 and 2 respectively; the second part has 2 digits, 1 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 3652-14:
(6*3)+(5*6)+(4*5)+(3*2)+(2*1)+(1*4)=80
80 % 10 = 0
So 3652-14-0 is a valid CAS Registry Number.
InChI:InChI=1/C9H8N4OS/c1-6(14)11-9-13-12-8(15-9)7-2-4-10-5-3-7/h2-5H,1H3,(H,11,13,14)
3652-14-0Relevant articles and documents
1H, 13C, 15N and19F NMR study of acetylation products of heterocyclic thiosemicarbazones
Larina, Lyudmila I.,Elokhina, Valentina N.,Yaroshenko, Tatyana I.,Nakhmanovich, Anatolii S.,Dolgushin, Gennadii V.
, p. 667 - 673 (2008/03/14)
Novel 2-acetylamino-4-acetyl-5-aryl(heteryl)-1,3,4-thiadiazolines, 2-acetylamino-5-aryl(heteryl)-1,3,4-thiadiazoles, and some of their salts were prepared and studied by multinuclear 1H, 13C, 15N, 19F and 2D NMR
