37535-49-2 Usage
Description
L-4-Pyridylalanine, also known as 3-(4-Pyridyl)-L-alanine, is a derivative of L-alanine, a non-essential amino acid naturally found in the human body and obtained through our diet. It is characterized by its white powder form and holds potential applications in various fields due to its unique chemical properties.
Uses
Used in Pharmaceutical Industry:
L-4-Pyridylalanine is used as an active pharmaceutical ingredient for the development of novel drugs targeting specific diseases. Its unique structure allows for the creation of new molecules with enhanced therapeutic properties, potentially leading to more effective treatments.
Used in Research and Development:
In the field of research, L-4-Pyridylalanine serves as a valuable compound for studying the structure and function of proteins and enzymes. It can be used as a building block in the synthesis of new bioactive molecules, contributing to the advancement of scientific knowledge and the development of innovative therapies.
Used in Chemical Synthesis:
L-4-Pyridylalanine is utilized as a key intermediate in the synthesis of various chemical compounds, including those with potential applications in the agrochemical, material science, and pharmaceutical industries. Its unique properties make it a versatile component in the creation of new molecules with specific functions and properties.
Used in Diagnostics:
L-4-Pyridylalanine can be employed in the development of diagnostic tools and assays, where its unique chemical properties may be leveraged to detect or monitor specific biological processes or conditions. This application could lead to improved diagnostic accuracy and patient care.
Check Digit Verification of cas no
The CAS Registry Mumber 37535-49-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,7,5,3 and 5 respectively; the second part has 2 digits, 4 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 37535-49:
(7*3)+(6*7)+(5*5)+(4*3)+(3*5)+(2*4)+(1*9)=132
132 % 10 = 2
So 37535-49-2 is a valid CAS Registry Number.
InChI:InChI=1/C8H10N2O2/c1-6(8(11)12)10-7-2-4-9-5-3-7/h2-6H,1H3,(H,9,10)(H,11,12)/t6-/m0/s1
37535-49-2Relevant articles and documents
Fused purine derivatives
-
, (2008/06/13)
A condensed purine derivative represented by Formula (I): wherein X—Y—Z represents R1N—C═O or N═C—W, R2 represents a hydrogen atom, a substituted or unsubstituted lower alkyl group, a substituted or unsubstituted aralkyl group, a substituted or unsubstituted aryl group, a substituted or unsubstituted aromatic heterocyclic group, a substituted or unsubstituted alicyclic heterocyclic group or the like, n represents an integer of from 0 to 3, V1 represents a hydrogen atom, a substituted or unsubstituted lower alkyl group, a substituted or unsubstituted aralkyl group, a substituted or unsubstituted aryl group, or a substituted or unsubstituted aromatic heterocyclic group, V2 represents a substituted lower alkyl group or a substituted or unsubstituted aromatic heterocyclic group, and when V1 represents a hydrogen atom, a lower alkyl group, a substituted or unsubstituted aralkyl group, or a substituted or unsubstituted aryl group, and for example, X—Y—Z represents R1aN—C═O and R2 represents a substituted lower alkyl group, a substituted or unsubstituted aralkyl group, a substituted or unsubstituted alicyclic heterocyclic group, a halogen atom, a lower alkylthio group, —NR7R8, —CO2H, a lower alkoxycarbonyl group, —COHal, —CONR9R10 or —CHO, V2 may represent a lower alkyl group, a substituted or unsubstituted aralkyl group, or a substituted or unsubstituted aryl group; or a pharmacologically acceptable salt thereof.
