37535-50-5 Usage
Description
D-4-Pyridylalanine, also known as 3-(4-Pyridyl)-D-alanine, is a derivative of the amino acid alanine (A480995). It is commonly found in bacteria, such as Streptococcus faecalis, and plays a crucial role in the biosynthesis of peptidoglycan crosslinking sub-units for bacterial cell walls. Additionally, D-4-Pyridylalanine is known to induce cytotoxic oxidative stress in brain tumor cells. It is a white powder in its chemical form.
Uses
Used in Pharmaceutical Industry:
D-4-Pyridylalanine is used as a pharmaceutical compound for its potential role in targeting bacterial cell walls and disrupting their biosynthesis. This property makes it a promising candidate for the development of new antibiotics, particularly against antibiotic-resistant strains of bacteria.
Used in Anticancer Applications:
D-4-Pyridylalanine is used as an anticancer agent, specifically for its ability to cause cytotoxic oxidative stress in brain tumor cells. This effect can potentially lead to the inhibition of tumor growth and the enhancement of the effectiveness of conventional cancer treatments.
Used in Drug Delivery Systems:
D-4-Pyridylalanine can be utilized in the development of drug delivery systems, particularly for targeted therapies against bacterial infections and brain tumors. Its unique properties allow for the design of novel drug carriers and delivery methods that can improve the bioavailability and therapeutic outcomes of treatments.
Check Digit Verification of cas no
The CAS Registry Mumber 37535-50-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,7,5,3 and 5 respectively; the second part has 2 digits, 5 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 37535-50:
(7*3)+(6*7)+(5*5)+(4*3)+(3*5)+(2*5)+(1*0)=125
125 % 10 = 5
So 37535-50-5 is a valid CAS Registry Number.
InChI:InChI=1/C8H10N2O2/c1-6(8(11)12)10-7-2-4-9-5-3-7/h2-6H,1H3,(H,9,10)(H,11,12)/t6-/m1/s1
