37777-76-7 Usage
Description
2-Chloro-6-fluorophenylacetic acid, with the CAS number 37777-76-7, is an organic compound characterized by its off-white to pale yellow crystalline solid appearance. It is primarily utilized in the field of organic synthesis, where its unique chemical structure contributes to the creation of various complex molecules and pharmaceuticals.
Uses
Used in Organic Synthesis:
2-Chloro-6-fluorophenylacetic acid is used as a synthetic building block for the development of a wide range of organic compounds. Its chemical properties, including the presence of a chlorine and a fluorine atom, make it a versatile starting material for the synthesis of various pharmaceuticals, agrochemicals, and other specialty chemicals.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 2-Chloro-6-fluorophenylacetic acid is used as an intermediate in the synthesis of various drugs. Its unique structure allows for the creation of molecules with specific biological activities, making it a valuable asset in the development of new medications for the treatment of various diseases and conditions.
Used in Agrochemical Industry:
2-Chloro-6-fluorophenylacetic acid also finds application in the agrochemical industry, where it is used as a precursor for the synthesis of various pesticides and other agricultural chemicals. Its chemical properties enable the development of compounds with targeted pest control capabilities, contributing to increased crop yields and more sustainable agricultural practices.
Used in Research and Development:
In addition to its practical applications, 2-Chloro-6-fluorophenylacetic acid is also used in research and development settings. Its unique structure and reactivity make it an interesting subject for studying various chemical reactions and exploring new synthetic pathways, ultimately contributing to the advancement of scientific knowledge in the field of organic chemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 37777-76-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,7,7,7 and 7 respectively; the second part has 2 digits, 7 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 37777-76:
(7*3)+(6*7)+(5*7)+(4*7)+(3*7)+(2*7)+(1*6)=167
167 % 10 = 7
So 37777-76-7 is a valid CAS Registry Number.
InChI:InChI=1/C8H6ClFO2/c9-6-2-1-3-7(10)5(6)4-8(11)12/h1-3H,4H2,(H,11,12)
