37828-88-9 Usage
Description
1-(2-bromoprop-2-en-1-yl)piperidine is a chemical compound that features a piperidine ring with a bromopropenyl group attached. 1-(2-bromoprop-2-en-1-yl)piperidine is known for its reactivity due to the presence of the bromine atom and is frequently utilized as a building block in the synthesis of more complex organic molecules. The piperidine ring within the molecule contributes to its biological activity, making it a valuable component in the design of pharmaceutical drugs.
Uses
Used in Organic Synthesis:
1-(2-bromoprop-2-en-1-yl)piperidine is used as a building block in organic synthesis for the creation of more complex organic molecules. Its reactivity, particularly due to the bromine atom, makes it a versatile compound for constructing a wide range of chemical structures.
Used in Pharmaceutical Research:
In the pharmaceutical industry, 1-(2-bromoprop-2-en-1-yl)piperidine is used as a key component in the design and development of new drugs. The biological activity conferred by the piperidine ring makes it a promising candidate for the creation of novel pharmaceutical compounds with potential applications in various therapeutic areas.
Used in Agrochemicals:
1-(2-bromoprop-2-en-1-yl)piperidine also finds applications in the agrochemical industry, where it is used as a starting material for the synthesis of various agrochemical products, such as pesticides and herbicides. Its reactivity and structural diversity make it a valuable asset in the development of new and effective agrochemicals.
Used in Materials Science:
In the field of materials science, 1-(2-bromoprop-2-en-1-yl)piperidine is utilized for the development of new materials with specific properties. Its unique structure and reactivity allow for the creation of materials with tailored characteristics, such as improved mechanical strength, thermal stability, or chemical resistance, depending on the desired application.
Check Digit Verification of cas no
The CAS Registry Mumber 37828-88-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,7,8,2 and 8 respectively; the second part has 2 digits, 8 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 37828-88:
(7*3)+(6*7)+(5*8)+(4*2)+(3*8)+(2*8)+(1*8)=159
159 % 10 = 9
So 37828-88-9 is a valid CAS Registry Number.
InChI:InChI=1/C8H14BrN/c1-8(9)7-10-5-3-2-4-6-10/h1-7H2
