37895-24-2 Usage
General Description
7-Methoxy-1,3-benzoxazine-2,4-dione is a chemical compound with the molecular formula C9H7NO4. It is classified as a benzoxazine-2,4-dione and is a derivative of benzoxazine. This chemical is primarily used in organic synthesis and pharmaceutical research. It has been studied for its potential therapeutic applications, particularly in the field of anti-cancer and anti-inflammatory medications. Additionally, 7-Methoxy-1,3-benzoxazine-2,4-dione is known for its ability to undergo various chemical reactions, making it a versatile compound for further scientific exploration and development.
Check Digit Verification of cas no
The CAS Registry Mumber 37895-24-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,7,8,9 and 5 respectively; the second part has 2 digits, 2 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 37895-24:
(7*3)+(6*7)+(5*8)+(4*9)+(3*5)+(2*2)+(1*4)=162
162 % 10 = 2
So 37895-24-2 is a valid CAS Registry Number.
InChI:InChI=1/C9H7NO4/c1-13-5-2-3-6-7(4-5)14-9(12)10-8(6)11/h2-4H,1H3,(H,10,11,12)
37895-24-2Relevant articles and documents
A novel strategy for the synthesis of uracil derivatives using bis(pentafluorophenyl)imidodicarbonate
Chichetti, Stephanie M.,Ahearn, Sean P.,Rivkin, Alexey
scheme or table, p. 6081 - 6083 (2009/04/04)
The disclosure herein describes a novel strategy for the synthesis of uracil derivatives via a solvent-free microwave cyclocondensation reaction using bis(pentafluorophenyl)imidodicarbonate.