37895-47-9 Usage
Structure
A derivative of 1,2,5-oxadiazole, a five-membered heterocyclic compound containing nitrogen and oxygen atoms in the ring.
Hydrazide group
Increases reactivity and potential for use in organic synthesis and medicinal chemistry.
Oxide group
Contributes to the compound's unique properties and potential applications.
Pharmaceuticals
Due to its unique structure and reactivity, it may be useful in the development of new drugs.
Agrochemicals
Its reactivity could make it a candidate for use in the development of new pesticides or other agricultural chemicals.
Materials science
The compound's properties may be harnessed for the creation of new materials with specific characteristics.
Further research
More studies are needed to fully understand the properties and potential uses of this compound.
Check Digit Verification of cas no
The CAS Registry Mumber 37895-47-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,7,8,9 and 5 respectively; the second part has 2 digits, 4 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 37895-47:
(7*3)+(6*7)+(5*8)+(4*9)+(3*5)+(2*4)+(1*7)=169
169 % 10 = 9
So 37895-47-9 is a valid CAS Registry Number.
InChI:InChI=1/C4H6N4O3/c1-2-3(4(9)6-5)8(10)11-7-2/h5,7,10H,1H3/b6-5+
