3861-43-6 Usage
Description
4-HYDROXY-3,5-DIIODOBENZONITRILE BENZOATE is a chemical compound that is a derivative of benzonitrile and benzoic acid. It has a hydroxy group and two iodine atoms attached to the benzene ring, as well as a benzoate group. 4-HYDROXY-3,5-DIIODOBENZONITRILE BENZOATE is known for its unique chemical properties and is commonly used in organic synthesis and pharmaceutical research.
Uses
Used in Organic Synthesis:
4-HYDROXY-3,5-DIIODOBENZONITRILE BENZOATE is used as a building block for the synthesis of various pharmaceuticals and agrochemicals. Its unique structure allows for the creation of a wide range of compounds with potential applications in different industries.
Used in Pharmaceutical Research:
In the pharmaceutical industry, 4-HYDROXY-3,5-DIIODOBENZONITRILE BENZOATE is used as a key intermediate in the development of new drugs. Its potential biological activities make it a valuable compound for research and development, with the aim of discovering new therapeutic agents.
Used in Agrochemical Research:
Similarly, in the agrochemical industry, 4-HYDROXY-3,5-DIIODOBENZONITRILE BENZOATE is used for the synthesis of various agrochemicals. Its unique properties contribute to the development of new products for agricultural applications, such as pesticides and herbicides.
Used in Therapeutic Applications:
4-HYDROXY-3,5-DIIODOBENZONITRILE BENZOATE has been studied for its potential therapeutic applications. Its unique chemical structure and properties make it a promising candidate for the development of new treatments for various diseases and conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 3861-43-6 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 3,8,6 and 1 respectively; the second part has 2 digits, 4 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 3861-43:
(6*3)+(5*8)+(4*6)+(3*1)+(2*4)+(1*3)=96
96 % 10 = 6
So 3861-43-6 is a valid CAS Registry Number.
InChI:InChI=1/C14H7I2NO2/c15-11-6-9(8-17)7-12(16)13(11)19-14(18)10-4-2-1-3-5-10/h1-7H
