38677-94-0 Usage
General Description
3-Cyclohexene-1-carboxylic acid, 2-(methylamino)-1-phenyl-, ethyl ester, (1R,2S)-rel- is a chemical compound that is an ethyl ester derivative of 3-cyclohexene-1-carboxylic acid. It also contains a methylamino group and a phenyl group, with a specific stereochemistry denoted as (1R,2S)-rel-. 3-Cyclohexene-1-carboxylic acid, 2-(methylamino)-1-phenyl-, ethyl ester, (1R,2S)-rel- may have potential applications in pharmaceutical and chemical research due to its unique structure and composition. Its specific properties and potential uses would need to be further investigated through experimentation and analysis.
Check Digit Verification of cas no
The CAS Registry Mumber 38677-94-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,8,6,7 and 7 respectively; the second part has 2 digits, 9 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 38677-94:
(7*3)+(6*8)+(5*6)+(4*7)+(3*7)+(2*9)+(1*4)=170
170 % 10 = 0
So 38677-94-0 is a valid CAS Registry Number.
InChI:InChI=1/C16H21NO2/c1-3-19-15(18)16(13-9-5-4-6-10-13)12-8-7-11-14(16)17-2/h4-7,9-11,14,17H,3,8,12H2,1-2H3/t14-,16+/m0/s1