387358-41-0 Usage
General Description
Pyrido[2,3-b][1,6]naphthyridine, 6,7,8,9-tetrahydro- (9CI) is a chemical compound classified under organic heterotricyclic compounds, specifically being a member of naphthyridines. Naphthyridines are compounds containing a naphthyridine moiety, which is a polycyclic aromatic hydrocarbon made up of two benzene rings fused to a piperidine ring. More information about this compound such as its physical and chemical properties, spectrum data, and potential reactions can be found in various scientific and chemical databases. Its use and effects largely depend on its structural conformation, so understanding these aspects is crucial for its safe handling and application in various fields.
Check Digit Verification of cas no
The CAS Registry Mumber 387358-41-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,8,7,3,5 and 8 respectively; the second part has 2 digits, 4 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 387358-41:
(8*3)+(7*8)+(6*7)+(5*3)+(4*5)+(3*8)+(2*4)+(1*1)=190
190 % 10 = 0
So 387358-41-0 is a valid CAS Registry Number.
InChI:InChI=1/C11H11N3/c1-2-8-6-9-7-12-5-3-10(9)14-11(8)13-4-1/h1-2,4,6,12H,3,5,7H2
