388088-75-3 Usage
Description
1,3-DIMETHYL-1H-THIENO[2,3-C]PYRAZOLE-5-CARBONYL CHLORIDE is a colorless liquid chemical compound with a pungent odor and high reactivity. It belongs to the class of carbonyl chlorides and is commonly used in various chemical processes.
Used in Organic Synthesis:
1,3-DIMETHYL-1H-THIENO[2,3-C]PYRAZOLE-5-CARBONYL CHLORIDE is used as a reagent for the introduction of the carbonyl chloride functional group into organic molecules, facilitating the synthesis of a wide range of organic compounds.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 1,3-DIMETHYL-1H-THIENO[2,3-C]PYRAZOLE-5-CARBONYL CHLORIDE is used for the synthesis of various drugs, contributing to the development of new medications and therapies.
Used in Agrochemical Production:
1,3-DIMETHYL-1H-THIENO[2,3-C]PYRAZOLE-5-CARBONYL CHLORIDE serves as a key intermediate in the production of agrochemicals, playing a crucial role in the development of agricultural products such as pesticides and herbicides.
Used in Dyes and Pigments Preparation:
This chemical compound is also utilized in the preparation of dyes and pigments, contributing to the coloration and appearance of various materials and products.
Safety Precautions:
Due to its reactivity and potential health hazards, it is essential to take proper safety precautions when handling 1,3-DIMETHYL-1H-THIENO[2,3-C]PYRAZOLE-5-CARBONYL CHLORIDE to ensure the safety of individuals and the environment.
Check Digit Verification of cas no
The CAS Registry Mumber 388088-75-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,8,8,0,8 and 8 respectively; the second part has 2 digits, 7 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 388088-75:
(8*3)+(7*8)+(6*8)+(5*0)+(4*8)+(3*8)+(2*7)+(1*5)=203
203 % 10 = 3
So 388088-75-3 is a valid CAS Registry Number.
InChI:InChI=1/C8H7ClN2OS/c1-4-5-3-6(7(9)12)13-8(5)11(2)10-4/h3H,1-2H3
C:Corrosive;
