38829-39-9 Usage
Description
3-Methyl-2-nitrofuran is a chemical compound that belongs to the nitrofuran family. It is an organic compound with the molecular formula C5H5N3O3 and a molecular weight of 155.11 g/mol. This yellow solid has a melting point of 47-49°C and is often used as a building block in organic synthesis and as a reagent in chemical reactions. Known for its antimicrobial properties, 3-Methyl-2-nitrofuran has been utilized in the development of pharmaceuticals and agrochemicals. However, due to its potentially hazardous nature, it is crucial to handle this chemical with care to minimize health and environmental risks.
Uses
Used in Organic Synthesis:
3-Methyl-2-nitrofuran is used as a building block in organic synthesis for the creation of various complex organic molecules. Its unique structure and reactivity make it a valuable component in the synthesis of pharmaceuticals, agrochemicals, and other specialty chemicals.
Used in Chemical Reactions:
As a reagent, 3-Methyl-2-nitrofuran is employed in a range of chemical reactions to facilitate the formation of desired products. Its participation in these reactions can lead to the development of new compounds with specific applications in various industries.
Used in Pharmaceutical Development:
Leveraging its antimicrobial properties, 3-Methyl-2-nitrofuran is used in the development of certain pharmaceuticals. Its ability to combat microorganisms makes it a potential candidate for the creation of new antibiotics and other therapeutic agents.
Used in Agrochemical Development:
3-Methyl-2-nitrofuran also finds application in the agrochemical industry, where it is utilized in the development of products designed to protect crops from microbial infections and pests. Its antimicrobial properties contribute to the enhancement of crop yields and food security.
Check Digit Verification of cas no
The CAS Registry Mumber 38829-39-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,8,8,2 and 9 respectively; the second part has 2 digits, 3 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 38829-39:
(7*3)+(6*8)+(5*8)+(4*2)+(3*9)+(2*3)+(1*9)=159
159 % 10 = 9
So 38829-39-9 is a valid CAS Registry Number.
InChI:InChI=1/C5H5NO3/c1-4-2-3-9-5(4)6(7)8/h2-3H,1H3
